C14H16ClN3O2 — CID 79474615
ethyl 2-(3-chlorophenyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)acetate (PubChem CID 79474615) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is ethyl 2-(3-chlorophenyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)acetate.
| Compound Name | ethyl 2-(3-chlorophenyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)acetate |
|---|---|
| PubChem CID | 79474615 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl 2-(3-chlorophenyl)-2-(5-ethyl-1H-1,2,4-triazol-3-yl)acetate |
| SMILES | CCOC(=O)C(c1cccc(Cl)c1)c1n[nH]c(CC)n1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-3-11-16-13(18-17-11)12(14(19)20-4-2)9-6-5-7-10(15)8-9/h5-8,12H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | NXORCCLGDWSAPN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |