C13H14BrN3O2 — CID 79475263
ethyl 2-(2-bromophenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate (PubChem CID 79475263) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is ethyl 2-(2-bromophenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate.
| Compound Name | ethyl 2-(2-bromophenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
|---|---|
| PubChem CID | 79475263 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | ethyl 2-(2-bromophenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
| SMILES | CCOC(=O)C(c1n[nH]c(C)n1)c1ccccc1Br |
| InChI | InChI=1S/C13H14BrN3O2/c1-3-19-13(18)11(12-15-8(2)16-17-12)9-6-4-5-7-10(9)14/h4-7,11H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | NGFCCWMLVPHEKL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |