C14H24N2OS — CID 79476515
4-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]piperidin-4-ol (PubChem CID 79476515) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 4-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]piperidin-4-ol.
| Compound Name | 4-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 79476515 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]piperidin-4-ol |
| SMILES | CC(Cc1cccs1)N(C)CC1(O)CCNCC1 |
| InChI | InChI=1S/C14H24N2OS/c1-12(10-13-4-3-9-18-13)16(2)11-14(17)5-7-15-8-6-14/h3-4,9,12,15,17H,5-8,10-11H2,1-2H3 |
| InChIKey | DESUSXSQDSFNDU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |