C16H21BrN2S — CID 79476608
2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(2-thiophen-2-ylethyl)aniline (PubChem CID 79476608) has the molecular formula C16H21BrN2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(2-thiophen-2-ylethyl)aniline.
| Compound Name | 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(2-thiophen-2-ylethyl)aniline |
|---|---|
| PubChem CID | 79476608 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(2-thiophen-2-ylethyl)aniline |
| SMILES | CNC(C)c1ccc(N(C)CCc2cccs2)c(Br)c1 |
| InChI | InChI=1S/C16H21BrN2S/c1-12(18-2)13-6-7-16(15(17)11-13)19(3)9-8-14-5-4-10-20-14/h4-7,10-12,18H,8-9H2,1-3H3 |
| InChIKey | PGBWNYFERAEOLC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|