C9H14N2O5S — CID 79477880
methyl 4-(1,2-oxazol-3-ylmethylsulfamoyl)butanoate (PubChem CID 79477880) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is methyl 4-(1,2-oxazol-3-ylmethylsulfamoyl)butanoate.
| Compound Name | methyl 4-(1,2-oxazol-3-ylmethylsulfamoyl)butanoate |
|---|---|
| PubChem CID | 79477880 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | methyl 4-(1,2-oxazol-3-ylmethylsulfamoyl)butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCc1ccon1 |
| InChI | InChI=1S/C9H14N2O5S/c1-15-9(12)3-2-6-17(13,14)10-7-8-4-5-16-11-8/h4-5,10H,2-3,6-7H2,1H3 |
| InChIKey | RIZQVJAFFUUNFL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |