C11H19N3O4S — CID 104626602
methyl 4-[2-(1-methylpyrazol-3-yl)ethylsulfamoyl]butanoate (PubChem CID 104626602) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is methyl 4-[2-(1-methylpyrazol-3-yl)ethylsulfamoyl]butanoate.
| Compound Name | methyl 4-[2-(1-methylpyrazol-3-yl)ethylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 104626602 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl 4-[2-(1-methylpyrazol-3-yl)ethylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCCc1ccn(C)n1 |
| InChI | InChI=1S/C11H19N3O4S/c1-14-8-6-10(13-14)5-7-12-19(16,17)9-3-4-11(15)18-2/h6,8,12H,3-5,7,9H2,1-2H3 |
| InChIKey | DYCRVTRHSMAZQK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |