C10H16N2O4S2 — CID 63830812
methyl 4-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]butanoate (PubChem CID 63830812) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 4-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]butanoate.
| Compound Name | methyl 4-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 63830812 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | methyl 4-[2-(1,3-thiazol-4-yl)ethylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCCc1cscn1 |
| InChI | InChI=1S/C10H16N2O4S2/c1-16-10(13)3-2-6-18(14,15)12-5-4-9-7-17-8-11-9/h7-8,12H,2-6H2,1H3 |
| InChIKey | UBFRXIZJCBVQFZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |