C14H21N3S — CID 79478206
2-N-ethyl-2-N-(2-methylbutyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 79478206) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(2-methylbutyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-ethyl-2-N-(2-methylbutyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 79478206 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-N-ethyl-2-N-(2-methylbutyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | CCC(C)CN(CC)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C14H21N3S/c1-4-10(3)9-17(5-2)14-16-12-7-6-11(15)8-13(12)18-14/h6-8,10H,4-5,9,15H2,1-3H3 |
| InChIKey | RQIADNGXQAKTII-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|