C11H9N5S — CID 63231234
2-[(6-amino-1,3-benzothiazol-2-yl)-(cyanomethyl)amino]acetonitrile (PubChem CID 63231234) has the molecular formula C11H9N5S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 63231234 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C11H9N5S/c12-3-5-16(6-4-13)11-15-9-2-1-8(14)7-10(9)17-11/h1-2,7H,5-6,14H2 |
| InChIKey | GWOCYABQICTZTA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|