C16H14N4S — CID 63231223
3-[[(6-amino-1,3-benzothiazol-2-yl)-methylamino]methyl]benzonitrile (PubChem CID 63231223) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[[(6-amino-1,3-benzothiazol-2-yl)-methylamino]methyl]benzonitrile.
| Compound Name | 3-[[(6-amino-1,3-benzothiazol-2-yl)-methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 63231223 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[[(6-amino-1,3-benzothiazol-2-yl)-methylamino]methyl]benzonitrile |
| SMILES | CN(Cc1cccc(C#N)c1)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C16H14N4S/c1-20(10-12-4-2-3-11(7-12)9-17)16-19-14-6-5-13(18)8-15(14)21-16/h2-8H,10,18H2,1H3 |
| InChIKey | WAWMUIWWCILNCS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|