C14H9N3OS — CID 55176316
3-[(6-amino-1,3-benzothiazol-2-yl)oxy]benzonitrile (PubChem CID 55176316) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzothiazol-2-yl)oxy]benzonitrile.
| Compound Name | 3-[(6-amino-1,3-benzothiazol-2-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 55176316 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-[(6-amino-1,3-benzothiazol-2-yl)oxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2nc3ccc(N)cc3s2)c1 |
| InChI | InChI=1S/C14H9N3OS/c15-8-9-2-1-3-11(6-9)18-14-17-12-5-4-10(16)7-13(12)19-14/h1-7H,16H2 |
| InChIKey | SHTWMSHDGFBPMO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|