C16H11N3OS — CID 107313184
2-quinolin-7-yloxy-1,3-benzothiazol-6-amine (PubChem CID 107313184) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-quinolin-7-yloxy-1,3-benzothiazol-6-amine.
| Compound Name | 2-quinolin-7-yloxy-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107313184 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-quinolin-7-yloxy-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(Oc3ccc4cccnc4c3)sc2c1 |
| InChI | InChI=1S/C16H11N3OS/c17-11-4-6-13-15(8-11)21-16(19-13)20-12-5-3-10-2-1-7-18-14(10)9-12/h1-9H,17H2 |
| InChIKey | IKZLHWJNNASOIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|