About calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride
calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride (PubChem CID 172810824) has the molecular formula C13H9CaCl3N2O
and a molecular weight of 355.67 g/mol. Its IUPAC name is calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride.
Molecular Properties
| Compound Name | calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride |
| PubChem CID | 172810824 |
| Molecular Formula | C13H9CaCl3N2O |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride |
| SMILES | N#Cc1cccc(Oc2ccc(N)cc2Cl)c1.[Ca+2].[Cl-].[Cl-] |
| InChI | InChI=1S/C13H9ClN2O.Ca.2ClH/c14-12-7-10(16)4-5-13(12)17-11-3-1-2-9(6-11)8-15;;;/h1-7H,16H2;;2*1H/q;+2;;/p-2 |
| InChIKey | SDNPZMVLEGXGCL-UHFFFAOYSA-L |
| XLogP | -2.79 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride?
The IUPAC name of calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride (CID 172810824) is calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride.
What is the SMILES notation for calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride?
The canonical SMILES for calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride is N#Cc1cccc(Oc2ccc(N)cc2Cl)c1.[Ca+2].[Cl-].[Cl-].
What is the InChIKey of calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride?
The InChIKey is SDNPZMVLEGXGCL-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H9ClN2O.Ca.2ClH/c14-12-7-10(16)4-5-13(12)17-11-3-1-2-9(6-11)8-15;;;/h1-7H,16H2;;2*1H/q;+2;;/p-2.
What are the key properties of calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride?
calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride has a molecular weight of 355.67 g/mol, XLogP of -2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;3-(4-amino-2-chlorophenoxy)benzonitrile;dichloride is sourced from PubChem (CID 172810824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).