C19H12F2N2O — CID 123333877
3-[5-amino-2-(3,5-difluorophenyl)phenoxy]benzonitrile (PubChem CID 123333877) has the molecular formula C19H12F2N2O and a molecular weight of 322.31 g/mol. Its IUPAC name is 3-[5-amino-2-(3,5-difluorophenyl)phenoxy]benzonitrile.
| Compound Name | 3-[5-amino-2-(3,5-difluorophenyl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 123333877 |
| Molecular Formula | C19H12F2N2O |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-[5-amino-2-(3,5-difluorophenyl)phenoxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(N)ccc2-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C19H12F2N2O/c20-14-7-13(8-15(21)9-14)18-5-4-16(23)10-19(18)24-17-3-1-2-12(6-17)11-22/h1-10H,23H2 |
| InChIKey | PDFRCPKLKKBUCU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|