C13H7Cl2NO — CID 86153533
3-(2,5-dichlorophenoxy)benzonitrile (PubChem CID 86153533) has the molecular formula C13H7Cl2NO and a molecular weight of 264.11 g/mol. Its IUPAC name is 3-(2,5-dichlorophenoxy)benzonitrile.
| Compound Name | 3-(2,5-dichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 86153533 |
| Molecular Formula | C13H7Cl2NO |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3-(2,5-dichlorophenoxy)benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H7Cl2NO/c14-10-4-5-12(15)13(7-10)17-11-3-1-2-9(6-11)8-16/h1-7H |
| InChIKey | HPJAVWSWXXHBEK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |