C9H16N2O5 — CID 79479127
(2R,4R)-1-[2-(2-aminoethoxy)acetyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 79479127) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is (2R,4R)-1-[2-(2-aminoethoxy)acetyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-1-[2-(2-aminoethoxy)acetyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79479127 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2R,4R)-1-[2-(2-aminoethoxy)acetyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | NCCOCC(=O)N1C[C@H](O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c10-1-2-16-5-8(13)11-4-6(12)3-7(11)9(14)15/h6-7,12H,1-5,10H2,(H,14,15)/t6-,7-/m1/s1 |
| InChIKey | BHFBNQJDXJBMKV-RNFRBKRXSA-N |
| XLogP | -1.99 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|