C17H27NO3 — CID 79482407
3-[3-[ethyl(2-methylbutyl)amino]propoxy]benzoic acid (PubChem CID 79482407) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[3-[ethyl(2-methylbutyl)amino]propoxy]benzoic acid.
| Compound Name | 3-[3-[ethyl(2-methylbutyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 79482407 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-[3-[ethyl(2-methylbutyl)amino]propoxy]benzoic acid |
| SMILES | CCC(C)CN(CC)CCCOc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H27NO3/c1-4-14(3)13-18(5-2)10-7-11-21-16-9-6-8-15(12-16)17(19)20/h6,8-9,12,14H,4-5,7,10-11,13H2,1-3H3,(H,19,20) |
| InChIKey | RLEKTHPYYOYSTN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|