C15H18FN3O2 — CID 79482482
ethyl 2-(4-fluorophenyl)-2-(4-propyl-1,2,4-triazol-3-yl)acetate (PubChem CID 79482482) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-2-(4-propyl-1,2,4-triazol-3-yl)acetate.
| Compound Name | ethyl 2-(4-fluorophenyl)-2-(4-propyl-1,2,4-triazol-3-yl)acetate |
|---|---|
| PubChem CID | 79482482 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-2-(4-propyl-1,2,4-triazol-3-yl)acetate |
| SMILES | CCCn1cnnc1C(C(=O)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN3O2/c1-3-9-19-10-17-18-14(19)13(15(20)21-4-2)11-5-7-12(16)8-6-11/h5-8,10,13H,3-4,9H2,1-2H3 |
| InChIKey | GTGRVSXAMVXNIV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |