C16H21N3O2 — CID 79482490
ethyl 3-phenyl-2-(4-propyl-1,2,4-triazol-3-yl)propanoate (PubChem CID 79482490) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 3-phenyl-2-(4-propyl-1,2,4-triazol-3-yl)propanoate.
| Compound Name | ethyl 3-phenyl-2-(4-propyl-1,2,4-triazol-3-yl)propanoate |
|---|---|
| PubChem CID | 79482490 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 3-phenyl-2-(4-propyl-1,2,4-triazol-3-yl)propanoate |
| SMILES | CCCn1cnnc1C(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H21N3O2/c1-3-10-19-12-17-18-15(19)14(16(20)21-4-2)11-13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11H2,1-2H3 |
| InChIKey | CHWXKSVDGVSVMV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |