C10H9F2N3 — CID 79488160
[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methanamine (PubChem CID 79488160) has the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methanamine.
| Compound Name | [5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 79488160 |
| Molecular Formula | C10H9F2N3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | [5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methanamine |
| SMILES | NCc1cn[nH]c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N3/c11-7-1-2-8(9(12)3-7)10-6(4-13)5-14-15-10/h1-3,5H,4,13H2,(H,14,15) |
| InChIKey | BEVMPMVAHSFHDO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |