C15H15F2N5 — CID 31043834
N-[[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine (PubChem CID 31043834) has the molecular formula C15H15F2N5 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 31043834 |
| Molecular Formula | C15H15F2N5 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[[5-(2,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Fc1ccc(-c2[nH]ncc2CNCCn2cccn2)c(F)c1 |
| InChI | InChI=1S/C15H15F2N5/c16-12-2-3-13(14(17)8-12)15-11(10-19-21-15)9-18-5-7-22-6-1-4-20-22/h1-4,6,8,10,18H,5,7,9H2,(H,19,21) |
| InChIKey | DJXMEVJIOPVCHO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|