C21H19ClFN5 — CID 26402492
N-[[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine (PubChem CID 26402492) has the molecular formula C21H19ClFN5 and a molecular weight of 395.87 g/mol. Its IUPAC name is N-[[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 26402492 |
| Molecular Formula | C21H19ClFN5 |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[[3-(2-chlorophenyl)-1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Fc1ccc(-n2cc(CNCCn3cccn3)c(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H19ClFN5/c22-20-5-2-1-4-19(20)21-16(14-24-11-13-27-12-3-10-25-27)15-28(26-21)18-8-6-17(23)7-9-18/h1-10,12,15,24H,11,13-14H2 |
| InChIKey | OUWUEBQHEFMDAK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|