C22H22FN5O — CID 42158119
N-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine (PubChem CID 42158119) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 42158119 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[[3-(2-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-2-pyrazol-1-ylethanamine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2CNCCn2cccn2)c(F)c1 |
| InChI | InChI=1S/C22H22FN5O/c1-29-19-8-9-20(21(23)14-19)22-17(15-24-11-13-27-12-5-10-25-27)16-28(26-22)18-6-3-2-4-7-18/h2-10,12,14,16,24H,11,13,15H2,1H3 |
| InChIKey | YSYZJUYGPUWGGU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|