C18H18F2N4 — CID 58683070
N-[[3,5-difluoro-2-(4-methyl-2-pyridinyl)phenyl]methyl]-2-pyrazol-1-ylethanamine (PubChem CID 58683070) has the molecular formula C18H18F2N4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[[3,5-difluoro-2-(4-methyl-2-pyridinyl)phenyl]methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[[3,5-difluoro-2-(4-methyl-2-pyridinyl)phenyl]methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 58683070 |
| Molecular Formula | C18H18F2N4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-[[3,5-difluoro-2-(4-methyl-2-pyridinyl)phenyl]methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Cc1ccnc(-c2c(F)cc(F)cc2CNCCn2cccn2)c1 |
| InChI | InChI=1S/C18H18F2N4/c1-13-3-5-22-17(9-13)18-14(10-15(19)11-16(18)20)12-21-6-8-24-7-2-4-23-24/h2-5,7,9-11,21H,6,8,12H2,1H3 |
| InChIKey | QJPVVSSBSXFCHS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|