C14H17F2N5 — CID 111901423
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine (PubChem CID 111901423) has the molecular formula C14H17F2N5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111901423 |
| Molecular Formula | C14H17F2N5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-pyrazol-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCCn1cccn1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H17F2N5/c1-17-14(18-6-8-21-7-2-5-20-21)19-10-11-9-12(15)3-4-13(11)16/h2-5,7,9H,6,8,10H2,1H3,(H2,17,18,19) |
| InChIKey | HIWOUBLGRQVUKL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|