C19H21F2N5 — CID 58683072
2-[2,4-difluoro-6-[(2-pyrazol-1-ylethylamino)methyl]phenyl]-N,N-dimethylpyridin-4-amine (PubChem CID 58683072) has the molecular formula C19H21F2N5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[2,4-difluoro-6-[(2-pyrazol-1-ylethylamino)methyl]phenyl]-N,N-dimethylpyridin-4-amine.
| Compound Name | 2-[2,4-difluoro-6-[(2-pyrazol-1-ylethylamino)methyl]phenyl]-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 58683072 |
| Molecular Formula | C19H21F2N5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-[2,4-difluoro-6-[(2-pyrazol-1-ylethylamino)methyl]phenyl]-N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)c1ccnc(-c2c(F)cc(F)cc2CNCCn2cccn2)c1 |
| InChI | InChI=1S/C19H21F2N5/c1-25(2)16-4-6-23-18(12-16)19-14(10-15(20)11-17(19)21)13-22-7-9-26-8-3-5-24-26/h3-6,8,10-12,22H,7,9,13H2,1-2H3 |
| InChIKey | QWCULDDHZZXXKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|