C15H16N4S2 — CID 79489153
3-[methyl(2-thiophen-2-ylethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 79489153) has the molecular formula C15H16N4S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-[methyl(2-thiophen-2-ylethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[methyl(2-thiophen-2-ylethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79489153 |
| Molecular Formula | C15H16N4S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[methyl(2-thiophen-2-ylethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | CN(CCc1cccs1)c1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C15H16N4S2/c1-18(10-9-13-8-5-11-21-13)14-16-17-15(20)19(14)12-6-3-2-4-7-12/h2-8,11H,9-10H2,1H3,(H,17,20) |
| InChIKey | ZGUXXUXDLNNQBU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|