C17H21N3O — CID 79490163
1H-indol-4-yl-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 79490163) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1H-indol-4-yl-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | 1H-indol-4-yl-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 79490163 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1H-indol-4-yl-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC1CN2CCCC2CN1C(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H21N3O/c1-12-10-19-9-3-4-13(19)11-20(12)17(21)15-5-2-6-16-14(15)7-8-18-16/h2,5-8,12-13,18H,3-4,9-11H2,1H3 |
| InChIKey | PKNNYBPZJQBEPT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |