C11H13IO3 — CID 79492104
3-(4-iodophenyl)-1,1-dimethoxypropan-2-one (PubChem CID 79492104) has the molecular formula C11H13IO3 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-(4-iodophenyl)-1,1-dimethoxypropan-2-one.
| Compound Name | 3-(4-iodophenyl)-1,1-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 79492104 |
| Molecular Formula | C11H13IO3 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3-(4-iodophenyl)-1,1-dimethoxypropan-2-one |
| SMILES | COC(OC)C(=O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C11H13IO3/c1-14-11(15-2)10(13)7-8-3-5-9(12)6-4-8/h3-6,11H,7H2,1-2H3 |
| InChIKey | DGJFSLDARHZIRU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|