C12H20N2O2 — CID 79492661
N-ethyl-1,1-dimethoxy-3-pyridin-2-ylpropan-2-amine (PubChem CID 79492661) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N-ethyl-1,1-dimethoxy-3-pyridin-2-ylpropan-2-amine.
| Compound Name | N-ethyl-1,1-dimethoxy-3-pyridin-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 79492661 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-ethyl-1,1-dimethoxy-3-pyridin-2-ylpropan-2-amine |
| SMILES | CCNC(Cc1ccccn1)C(OC)OC |
| InChI | InChI=1S/C12H20N2O2/c1-4-13-11(12(15-2)16-3)9-10-7-5-6-8-14-10/h5-8,11-13H,4,9H2,1-3H3 |
| InChIKey | ZWRPLVXYAHXKOQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|