C16H22N2O2 — CID 79492792
N-(1-isoquinolin-4-yl-2,2-dimethoxyethyl)propan-1-amine (PubChem CID 79492792) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(1-isoquinolin-4-yl-2,2-dimethoxyethyl)propan-1-amine.
| Compound Name | N-(1-isoquinolin-4-yl-2,2-dimethoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 79492792 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(1-isoquinolin-4-yl-2,2-dimethoxyethyl)propan-1-amine |
| SMILES | CCCNC(c1cncc2ccccc12)C(OC)OC |
| InChI | InChI=1S/C16H22N2O2/c1-4-9-18-15(16(19-2)20-3)14-11-17-10-12-7-5-6-8-13(12)14/h5-8,10-11,15-16,18H,4,9H2,1-3H3 |
| InChIKey | LHIKFXHDIZTWNT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|