C8H7ClN4O — CID 79493420
6-chloro-N-(1,2-oxazol-3-ylmethyl)pyrazin-2-amine (PubChem CID 79493420) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 6-chloro-N-(1,2-oxazol-3-ylmethyl)pyrazin-2-amine.
| Compound Name | 6-chloro-N-(1,2-oxazol-3-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 79493420 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 6-chloro-N-(1,2-oxazol-3-ylmethyl)pyrazin-2-amine |
| SMILES | Clc1cncc(NCc2ccon2)n1 |
| InChI | InChI=1S/C8H7ClN4O/c9-7-4-10-5-8(12-7)11-3-6-1-2-14-13-6/h1-2,4-5H,3H2,(H,11,12) |
| InChIKey | FPKLIQJSTXKCFU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |