C12H25NO2 — CID 79493446
1-(3-ethylcyclohexyl)-2,2-dimethoxyethanamine (PubChem CID 79493446) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-2,2-dimethoxyethanamine.
| Compound Name | 1-(3-ethylcyclohexyl)-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 79493446 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-2,2-dimethoxyethanamine |
| SMILES | CCC1CCCC(C(N)C(OC)OC)C1 |
| InChI | InChI=1S/C12H25NO2/c1-4-9-6-5-7-10(8-9)11(13)12(14-2)15-3/h9-12H,4-8,13H2,1-3H3 |
| InChIKey | DKHDXDDNOJTXIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|