C17H32N2S — CID 79494543
N'-methyl-N-(2-methylpropyl)-N'-(2-thiophen-2-ylethyl)hexane-1,6-diamine (PubChem CID 79494543) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is N'-methyl-N-(2-methylpropyl)-N'-(2-thiophen-2-ylethyl)hexane-1,6-diamine.
| Compound Name | N'-methyl-N-(2-methylpropyl)-N'-(2-thiophen-2-ylethyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 79494543 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N'-methyl-N-(2-methylpropyl)-N'-(2-thiophen-2-ylethyl)hexane-1,6-diamine |
| SMILES | CC(C)CNCCCCCCN(C)CCc1cccs1 |
| InChI | InChI=1S/C17H32N2S/c1-16(2)15-18-11-6-4-5-7-12-19(3)13-10-17-9-8-14-20-17/h8-9,14,16,18H,4-7,10-13,15H2,1-3H3 |
| InChIKey | RXVUFDAGYAJPHF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|