C12H23NO2 — CID 79495885
1,1-diethoxy-N-ethylhex-4-yn-2-amine (PubChem CID 79495885) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,1-diethoxy-N-ethylhex-4-yn-2-amine.
| Compound Name | 1,1-diethoxy-N-ethylhex-4-yn-2-amine |
|---|---|
| PubChem CID | 79495885 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1,1-diethoxy-N-ethylhex-4-yn-2-amine |
| SMILES | CC#CCC(NCC)C(OCC)OCC |
| InChI | InChI=1S/C12H23NO2/c1-5-9-10-11(13-6-2)12(14-7-3)15-8-4/h11-13H,6-8,10H2,1-4H3 |
| InChIKey | OJTAVHPTDNFDFZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|