C15H29NO — CID 116725712
3-ethoxy-N-ethyl-2,2-dimethylnon-7-yn-4-amine (PubChem CID 116725712) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-2,2-dimethylnon-7-yn-4-amine.
| Compound Name | 3-ethoxy-N-ethyl-2,2-dimethylnon-7-yn-4-amine |
|---|---|
| PubChem CID | 116725712 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 3-ethoxy-N-ethyl-2,2-dimethylnon-7-yn-4-amine |
| SMILES | CC#CCCC(NCC)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C15H29NO/c1-7-10-11-12-13(16-8-2)14(17-9-3)15(4,5)6/h13-14,16H,8-9,11-12H2,1-6H3 |
| InChIKey | WNEJSCHHMDBFGO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|