C13H14N2O — CID 79496015
(E)-N-(1,2-oxazol-3-ylmethyl)-3-phenylprop-2-en-1-amine (PubChem CID 79496015) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (E)-N-(1,2-oxazol-3-ylmethyl)-3-phenylprop-2-en-1-amine.
| Compound Name | (E)-N-(1,2-oxazol-3-ylmethyl)-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79496015 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (E)-N-(1,2-oxazol-3-ylmethyl)-3-phenylprop-2-en-1-amine |
| SMILES | C(=C/c1ccccc1)\CNCc1ccon1 |
| InChI | InChI=1S/C13H14N2O/c1-2-5-12(6-3-1)7-4-9-14-11-13-8-10-16-15-13/h1-8,10,14H,9,11H2/b7-4+ |
| InChIKey | HJJJTWDSZBYBTO-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|