C17H25N3O — CID 79498731
5-cyclohexyl-1-(4-methoxyphenyl)-5-methyl-4H-imidazol-2-amine (PubChem CID 79498731) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 5-cyclohexyl-1-(4-methoxyphenyl)-5-methyl-4H-imidazol-2-amine.
| Compound Name | 5-cyclohexyl-1-(4-methoxyphenyl)-5-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79498731 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 5-cyclohexyl-1-(4-methoxyphenyl)-5-methyl-4H-imidazol-2-amine |
| SMILES | COc1ccc(N2C(N)=NCC2(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-17(13-6-4-3-5-7-13)12-19-16(18)20(17)14-8-10-15(21-2)11-9-14/h8-11,13H,3-7,12H2,1-2H3,(H2,18,19) |
| InChIKey | XLSNEKPVNQRMET-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |