C17H25N3O — CID 79498559
6-ethyl-1-(4-methoxyphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79498559) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 6-ethyl-1-(4-methoxyphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 6-ethyl-1-(4-methoxyphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79498559 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 6-ethyl-1-(4-methoxyphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCC1CCCCC12CN=C(N)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-3-13-6-4-5-11-17(13)12-19-16(18)20(17)14-7-9-15(21-2)10-8-14/h7-10,13H,3-6,11-12H2,1-2H3,(H2,18,19) |
| InChIKey | PYHKJNGYTDLRSO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |