C11H21N3O — CID 106874943
1-ethyl-6-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 106874943) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-ethyl-6-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-ethyl-6-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 106874943 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-ethyl-6-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCN1C(N)=NCC12CCCCC2OC |
| InChI | InChI=1S/C11H21N3O/c1-3-14-10(12)13-8-11(14)7-5-4-6-9(11)15-2/h9H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | OROBFYNFZIJITE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |