C12H20N4O — CID 114239234
2'-amino-1'-ethylspiro[2,5,6,7,8,8a-hexahydroindolizine-1,5'-4H-imidazole]-3-one (PubChem CID 114239234) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2'-amino-1'-ethylspiro[2,5,6,7,8,8a-hexahydroindolizine-1,5'-4H-imidazole]-3-one.
| Compound Name | 2'-amino-1'-ethylspiro[2,5,6,7,8,8a-hexahydroindolizine-1,5'-4H-imidazole]-3-one |
|---|---|
| PubChem CID | 114239234 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2'-amino-1'-ethylspiro[2,5,6,7,8,8a-hexahydroindolizine-1,5'-4H-imidazole]-3-one |
| SMILES | CCN1C(N)=NCC12CC(=O)N1CCCCC12 |
| InChI | InChI=1S/C12H20N4O/c1-2-16-11(13)14-8-12(16)7-10(17)15-6-4-3-5-9(12)15/h9H,2-8H2,1H3,(H2,13,14) |
| InChIKey | BBVYYCXXNMEFJJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |