C12H23N3O — CID 106874945
6-methoxy-1-propyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 106874945) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-methoxy-1-propyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 6-methoxy-1-propyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 106874945 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 6-methoxy-1-propyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCCN1C(N)=NCC12CCCCC2OC |
| InChI | InChI=1S/C12H23N3O/c1-3-8-15-11(13)14-9-12(15)7-5-4-6-10(12)16-2/h10H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | XDIIWKBYUGVZNZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |