C17H32N4 — CID 79496898
1-cycloheptyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79496898) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-cycloheptyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-cycloheptyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79496898 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 1-cycloheptyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCCN1CCC2(CC1)CN=C(N)N2C1CCCCCC1 |
| InChI | InChI=1S/C17H32N4/c1-2-11-20-12-9-17(10-13-20)14-19-16(18)21(17)15-7-5-3-4-6-8-15/h15H,2-14H2,1H3,(H2,18,19) |
| InChIKey | BNNIDONPHGJGHK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |