C16H15ClFN3 — CID 79502372
1-(4-chlorophenyl)-5-(3-fluorophenyl)-5-methyl-4H-imidazol-2-amine (PubChem CID 79502372) has the molecular formula C16H15ClFN3 and a molecular weight of 303.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(3-fluorophenyl)-5-methyl-4H-imidazol-2-amine.
| Compound Name | 1-(4-chlorophenyl)-5-(3-fluorophenyl)-5-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79502372 |
| Molecular Formula | C16H15ClFN3 |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(3-fluorophenyl)-5-methyl-4H-imidazol-2-amine |
| SMILES | CC1(c2cccc(F)c2)CN=C(N)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClFN3/c1-16(11-3-2-4-13(18)9-11)10-20-15(19)21(16)14-7-5-12(17)6-8-14/h2-9H,10H2,1H3,(H2,19,20) |
| InChIKey | XLIGYNGKRRTIOY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |