C11H13ClFN3 — CID 79510819
5-(3-chloro-4-fluorophenyl)-1,5-dimethyl-4H-imidazol-2-amine (PubChem CID 79510819) has the molecular formula C11H13ClFN3 and a molecular weight of 241.70 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-1,5-dimethyl-4H-imidazol-2-amine.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-1,5-dimethyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79510819 |
| Molecular Formula | C11H13ClFN3 |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-1,5-dimethyl-4H-imidazol-2-amine |
| SMILES | CN1C(N)=NCC1(C)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClFN3/c1-11(6-15-10(14)16(11)2)7-3-4-9(13)8(12)5-7/h3-5H,6H2,1-2H3,(H2,14,15) |
| InChIKey | YOXMTNKCFGKVER-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |