C13H20N4 — CID 79510351
5-[4-(dimethylamino)phenyl]-1,5-dimethyl-4H-imidazol-2-amine (PubChem CID 79510351) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-1,5-dimethyl-4H-imidazol-2-amine.
| Compound Name | 5-[4-(dimethylamino)phenyl]-1,5-dimethyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79510351 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-1,5-dimethyl-4H-imidazol-2-amine |
| SMILES | CN(C)c1ccc(C2(C)CN=C(N)N2C)cc1 |
| InChI | InChI=1S/C13H20N4/c1-13(9-15-12(14)17(13)4)10-5-7-11(8-6-10)16(2)3/h5-8H,9H2,1-4H3,(H2,14,15) |
| InChIKey | GCQAFWKDHCWJSE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|