C13H18N2O — CID 79504547
2-phenyl-2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethanol (PubChem CID 79504547) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-phenyl-2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethanol.
| Compound Name | 2-phenyl-2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethanol |
|---|---|
| PubChem CID | 79504547 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-phenyl-2-(2,3,4,5-tetrahydropyridin-6-ylamino)ethanol |
| SMILES | OCC(NC1=NCCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O/c16-10-12(11-6-2-1-3-7-11)15-13-8-4-5-9-14-13/h1-3,6-7,12,16H,4-5,8-10H2,(H,14,15) |
| InChIKey | BCXPFXHRFZWCFS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |