C20H24N2 — CID 19771634
N-(1,4-diphenylbutyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 19771634) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-(1,4-diphenylbutyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(1,4-diphenylbutyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 19771634 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-(1,4-diphenylbutyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | c1ccc(CCCC(NC2=NCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2/c1-3-9-17(10-4-1)11-7-14-19(18-12-5-2-6-13-18)22-20-15-8-16-21-20/h1-6,9-10,12-13,19H,7-8,11,14-16H2,(H,21,22) |
| InChIKey | NTAHICZLRCAATO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |