C13H16ClN3S — CID 79504898
1-(2-chlorophenyl)-8-thia-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79504898) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-8-thia-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-(2-chlorophenyl)-8-thia-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79504898 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(2-chlorophenyl)-8-thia-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | NC1=NCC2(CCSCC2)N1c1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3S/c14-10-3-1-2-4-11(10)17-12(15)16-9-13(17)5-7-18-8-6-13/h1-4H,5-9H2,(H2,15,16) |
| InChIKey | KOUVSFMLFCFHEG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |