C12H25N3O — CID 79504925
1-(2-methoxyethyl)-5,5-dipropyl-4H-imidazol-2-amine (PubChem CID 79504925) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5,5-dipropyl-4H-imidazol-2-amine.
| Compound Name | 1-(2-methoxyethyl)-5,5-dipropyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79504925 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 1-(2-methoxyethyl)-5,5-dipropyl-4H-imidazol-2-amine |
| SMILES | CCCC1(CCC)CN=C(N)N1CCOC |
| InChI | InChI=1S/C12H25N3O/c1-4-6-12(7-5-2)10-14-11(13)15(12)8-9-16-3/h4-10H2,1-3H3,(H2,13,14) |
| InChIKey | GQJFGYCWOKHPSI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |